C21H21N5O7 — CID 3829106
[4-[6-(2,6-dimethoxyphenoxy)-5-nitropyrimidin-4-yl]piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 3829106) has the molecular formula C21H21N5O7 and a molecular weight of 455.43 g/mol. Its IUPAC name is [4-[6-(2,6-dimethoxyphenoxy)-5-nitropyrimidin-4-yl]piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[6-(2,6-dimethoxyphenoxy)-5-nitropyrimidin-4-yl]piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 3829106 |
| Molecular Formula | C21H21N5O7 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | [4-[6-(2,6-dimethoxyphenoxy)-5-nitropyrimidin-4-yl]piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | COc1cccc(OC)c1Oc1ncnc(N2CCN(C(=O)c3ccco3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H21N5O7/c1-30-14-5-3-6-15(31-2)18(14)33-20-17(26(28)29)19(22-13-23-20)24-8-10-25(11-9-24)21(27)16-7-4-12-32-16/h3-7,12-13H,8-11H2,1-2H3 |
| InChIKey | NVUAHWIKACVSHS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 133.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|