C21H19N5O7 — CID 3471860
methyl 3-[6-[4-(furan-2-carbonyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]oxybenzoate (PubChem CID 3471860) has the molecular formula C21H19N5O7 and a molecular weight of 453.41 g/mol. Its IUPAC name is methyl 3-[6-[4-(furan-2-carbonyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]oxybenzoate.
| Compound Name | methyl 3-[6-[4-(furan-2-carbonyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]oxybenzoate |
|---|---|
| PubChem CID | 3471860 |
| Molecular Formula | C21H19N5O7 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | methyl 3-[6-[4-(furan-2-carbonyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]oxybenzoate |
| SMILES | COC(=O)c1cccc(Oc2ncnc(N3CCN(C(=O)c4ccco4)CC3)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H19N5O7/c1-31-21(28)14-4-2-5-15(12-14)33-19-17(26(29)30)18(22-13-23-19)24-7-9-25(10-8-24)20(27)16-6-3-11-32-16/h2-6,11-13H,7-10H2,1H3 |
| InChIKey | NOEBQDTUEWFQKO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 141.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|