C22H20ClN5O5 — CID 23483279
methyl 4-[6-[4-(3-chlorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]oxybenzoate (PubChem CID 23483279) has the molecular formula C22H20ClN5O5 and a molecular weight of 469.89 g/mol. Its IUPAC name is methyl 4-[6-[4-(3-chlorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]oxybenzoate.
| Compound Name | methyl 4-[6-[4-(3-chlorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]oxybenzoate |
|---|---|
| PubChem CID | 23483279 |
| Molecular Formula | C22H20ClN5O5 |
| Molecular Weight | 469.89 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | methyl 4-[6-[4-(3-chlorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]oxybenzoate |
| SMILES | COC(=O)c1ccc(Oc2ncnc(N3CCN(c4cccc(Cl)c4)CC3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H20ClN5O5/c1-32-22(29)15-5-7-18(8-6-15)33-21-19(28(30)31)20(24-14-25-21)27-11-9-26(10-12-27)17-4-2-3-16(23)13-17/h2-8,13-14H,9-12H2,1H3 |
| InChIKey | NTNKEHKIYYLRJF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 110.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.89 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|