methyl 4-(5-nitro-6-propan-2-yloxypyrimidin-4-yl)oxybenzoate

C15H15N3O6 — CID 23483400

IUPACmethyl 4-(5-nitro-6-propan-2-yloxypyrimidin-4-yl)oxybenzoate
SMILESCOC(=O)c1ccc(Oc2ncnc(OC(C)C)c2[N+](=O)[O-])cc1
InChIInChI=1S/C15H15N3O6/c1-9(2)23-13-12(18(20)21)14(17-8-16-13)24-11-6-4-10(5-7-11)15(19)22-3/h4-9H,1-3H3
InChIKeyIDVGSSCVUHPDPZ-UHFFFAOYSA-N
MW333.30 g/mol
LogP2.75
Rot. Bonds6

About methyl 4-(5-nitro-6-propan-2-yloxypyrimidin-4-yl)oxybenzoate

methyl 4-(5-nitro-6-propan-2-yloxypyrimidin-4-yl)oxybenzoate (PubChem CID 23483400) has the molecular formula C15H15N3O6 and a molecular weight of 333.30 g/mol. Its IUPAC name is methyl 4-(5-nitro-6-propan-2-yloxypyrimidin-4-yl)oxybenzoate.

Molecular Properties

Compound Namemethyl 4-(5-nitro-6-propan-2-yloxypyrimidin-4-yl)oxybenzoate
PubChem CID23483400
Molecular FormulaC15H15N3O6
Molecular Weight333.30 g/mol
Exact Mass333.10
IUPAC Namemethyl 4-(5-nitro-6-propan-2-yloxypyrimidin-4-yl)oxybenzoate
SMILESCOC(=O)c1ccc(Oc2ncnc(OC(C)C)c2[N+](=O)[O-])cc1
InChIInChI=1S/C15H15N3O6/c1-9(2)23-13-12(18(20)21)14(17-8-16-13)24-11-6-4-10(5-7-11)15(19)22-3/h4-9H,1-3H3
InChIKeyIDVGSSCVUHPDPZ-UHFFFAOYSA-N
XLogP2.75
TPSA113.68 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds6
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500333.30
LogP ≤ 52.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 4-(5-nitro-6-propan-2-yloxypyrimidin-4-yl)oxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(5-nitro-6-propan-2-yloxypyrimidin-4-yl)oxybenzoate?
The IUPAC name of methyl 4-(5-nitro-6-propan-2-yloxypyrimidin-4-yl)oxybenzoate (CID 23483400) is methyl 4-(5-nitro-6-propan-2-yloxypyrimidin-4-yl)oxybenzoate.
What is the SMILES notation for methyl 4-(5-nitro-6-propan-2-yloxypyrimidin-4-yl)oxybenzoate?
The canonical SMILES for methyl 4-(5-nitro-6-propan-2-yloxypyrimidin-4-yl)oxybenzoate is COC(=O)c1ccc(Oc2ncnc(OC(C)C)c2[N+](=O)[O-])cc1.
What is the InChIKey of methyl 4-(5-nitro-6-propan-2-yloxypyrimidin-4-yl)oxybenzoate?
The InChIKey is IDVGSSCVUHPDPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O6/c1-9(2)23-13-12(18(20)21)14(17-8-16-13)24-11-6-4-10(5-7-11)15(19)22-3/h4-9H,1-3H3.
What are the key properties of methyl 4-(5-nitro-6-propan-2-yloxypyrimidin-4-yl)oxybenzoate?
methyl 4-(5-nitro-6-propan-2-yloxypyrimidin-4-yl)oxybenzoate has a molecular weight of 333.30 g/mol, XLogP of 2.75, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(5-nitro-6-propan-2-yloxypyrimidin-4-yl)oxybenzoate is sourced from PubChem (CID 23483400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).