C19H16BrN5O5 — CID 3801431
[4-[6-(2-bromophenoxy)-5-nitropyrimidin-4-yl]piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 3801431) has the molecular formula C19H16BrN5O5 and a molecular weight of 474.27 g/mol. Its IUPAC name is [4-[6-(2-bromophenoxy)-5-nitropyrimidin-4-yl]piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[6-(2-bromophenoxy)-5-nitropyrimidin-4-yl]piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 3801431 |
| Molecular Formula | C19H16BrN5O5 |
| Molecular Weight | 474.27 g/mol |
| Exact Mass | 473.03 |
| IUPAC Name | [4-[6-(2-bromophenoxy)-5-nitropyrimidin-4-yl]piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCN(c2ncnc(Oc3ccccc3Br)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H16BrN5O5/c20-13-4-1-2-5-14(13)30-18-16(25(27)28)17(21-12-22-18)23-7-9-24(10-8-23)19(26)15-6-3-11-29-15/h1-6,11-12H,7-10H2 |
| InChIKey | NCOZNRTUYBIJDS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 114.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|