C22H20N6O4S — CID 3586304
[4-[6-(1-benzothiophen-3-ylmethylamino)-5-nitropyrimidin-4-yl]piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 3586304) has the molecular formula C22H20N6O4S and a molecular weight of 464.51 g/mol. Its IUPAC name is [4-[6-(1-benzothiophen-3-ylmethylamino)-5-nitropyrimidin-4-yl]piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[6-(1-benzothiophen-3-ylmethylamino)-5-nitropyrimidin-4-yl]piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 3586304 |
| Molecular Formula | C22H20N6O4S |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | [4-[6-(1-benzothiophen-3-ylmethylamino)-5-nitropyrimidin-4-yl]piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCN(c2ncnc(NCc3csc4ccccc34)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H20N6O4S/c29-22(17-5-3-11-32-17)27-9-7-26(8-10-27)21-19(28(30)31)20(24-14-25-21)23-12-15-13-33-18-6-2-1-4-16(15)18/h1-6,11,13-14H,7-10,12H2,(H,23,24,25) |
| InChIKey | KGGWPTVNDWNVEV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|