C21H19F3N6O4 — CID 3489436
furan-2-yl-[4-[5-nitro-6-[[2-(trifluoromethyl)phenyl]methylamino]pyrimidin-4-yl]piperazin-1-yl]methanone (PubChem CID 3489436) has the molecular formula C21H19F3N6O4 and a molecular weight of 476.42 g/mol. Its IUPAC name is furan-2-yl-[4-[5-nitro-6-[[2-(trifluoromethyl)phenyl]methylamino]pyrimidin-4-yl]piperazin-1-yl]methanone.
| Compound Name | furan-2-yl-[4-[5-nitro-6-[[2-(trifluoromethyl)phenyl]methylamino]pyrimidin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 3489436 |
| Molecular Formula | C21H19F3N6O4 |
| Molecular Weight | 476.42 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | furan-2-yl-[4-[5-nitro-6-[[2-(trifluoromethyl)phenyl]methylamino]pyrimidin-4-yl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccco1)N1CCN(c2ncnc(NCc3ccccc3C(F)(F)F)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H19F3N6O4/c22-21(23,24)15-5-2-1-4-14(15)12-25-18-17(30(32)33)19(27-13-26-18)28-7-9-29(10-8-28)20(31)16-6-3-11-34-16/h1-6,11,13H,7-10,12H2,(H,25,26,27) |
| InChIKey | ZISVQJYZXCHUHV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|