C22H24N6O6 — CID 3690679
[4-[6-[(2,3-dimethoxyphenyl)methylamino]-5-nitropyrimidin-4-yl]piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 3690679) has the molecular formula C22H24N6O6 and a molecular weight of 468.47 g/mol. Its IUPAC name is [4-[6-[(2,3-dimethoxyphenyl)methylamino]-5-nitropyrimidin-4-yl]piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[6-[(2,3-dimethoxyphenyl)methylamino]-5-nitropyrimidin-4-yl]piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 3690679 |
| Molecular Formula | C22H24N6O6 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | [4-[6-[(2,3-dimethoxyphenyl)methylamino]-5-nitropyrimidin-4-yl]piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | COc1cccc(CNc2ncnc(N3CCN(C(=O)c4ccco4)CC3)c2[N+](=O)[O-])c1OC |
| InChI | InChI=1S/C22H24N6O6/c1-32-16-6-3-5-15(19(16)33-2)13-23-20-18(28(30)31)21(25-14-24-20)26-8-10-27(11-9-26)22(29)17-7-4-12-34-17/h3-7,12,14H,8-11,13H2,1-2H3,(H,23,24,25) |
| InChIKey | PPNKSZZOUQSVQY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|