C19H19N5O5 — CID 3340403
1-[7-[6-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-yl]oxy-1-benzofuran-2-yl]ethanone (PubChem CID 3340403) has the molecular formula C19H19N5O5 and a molecular weight of 397.39 g/mol. Its IUPAC name is 1-[7-[6-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-yl]oxy-1-benzofuran-2-yl]ethanone.
| Compound Name | 1-[7-[6-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-yl]oxy-1-benzofuran-2-yl]ethanone |
|---|---|
| PubChem CID | 3340403 |
| Molecular Formula | C19H19N5O5 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 1-[7-[6-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-yl]oxy-1-benzofuran-2-yl]ethanone |
| SMILES | CC(=O)c1cc2cccc(Oc3ncnc(N4CCN(C)CC4)c3[N+](=O)[O-])c2o1 |
| InChI | InChI=1S/C19H19N5O5/c1-12(25)15-10-13-4-3-5-14(17(13)28-15)29-19-16(24(26)27)18(20-11-21-19)23-8-6-22(2)7-9-23/h3-5,10-11H,6-9H2,1-2H3 |
| InChIKey | AJBLNSMTLIOSRO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 114.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|