C20H21N5O6 — CID 23857461
4-(methoxymethyl)-7-[6-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-yl]oxychromen-2-one (PubChem CID 23857461) has the molecular formula C20H21N5O6 and a molecular weight of 427.42 g/mol. Its IUPAC name is 4-(methoxymethyl)-7-[6-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-yl]oxychromen-2-one.
| Compound Name | 4-(methoxymethyl)-7-[6-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-yl]oxychromen-2-one |
|---|---|
| PubChem CID | 23857461 |
| Molecular Formula | C20H21N5O6 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 4-(methoxymethyl)-7-[6-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-yl]oxychromen-2-one |
| SMILES | COCc1cc(=O)oc2cc(Oc3ncnc(N4CCN(C)CC4)c3[N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C20H21N5O6/c1-23-5-7-24(8-6-23)19-18(25(27)28)20(22-12-21-19)30-14-3-4-15-13(11-29-2)9-17(26)31-16(15)10-14/h3-4,9-10,12H,5-8,11H2,1-2H3 |
| InChIKey | VWVWFBHITHVVCS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 124.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|