C25H24N4O9 — CID 3667802
ethyl 3-[furan-2-ylmethyl-[6-[4-(methoxymethyl)-2-oxochromen-7-yl]oxy-5-nitropyrimidin-4-yl]amino]propanoate (PubChem CID 3667802) has the molecular formula C25H24N4O9 and a molecular weight of 524.49 g/mol. Its IUPAC name is ethyl 3-[furan-2-ylmethyl-[6-[4-(methoxymethyl)-2-oxochromen-7-yl]oxy-5-nitropyrimidin-4-yl]amino]propanoate.
| Compound Name | ethyl 3-[furan-2-ylmethyl-[6-[4-(methoxymethyl)-2-oxochromen-7-yl]oxy-5-nitropyrimidin-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 3667802 |
| Molecular Formula | C25H24N4O9 |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | ethyl 3-[furan-2-ylmethyl-[6-[4-(methoxymethyl)-2-oxochromen-7-yl]oxy-5-nitropyrimidin-4-yl]amino]propanoate |
| SMILES | CCOC(=O)CCN(Cc1ccco1)c1ncnc(Oc2ccc3c(COC)cc(=O)oc3c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C25H24N4O9/c1-3-35-21(30)8-9-28(13-18-5-4-10-36-18)24-23(29(32)33)25(27-15-26-24)37-17-6-7-19-16(14-34-2)11-22(31)38-20(19)12-17/h4-7,10-12,15H,3,8-9,13-14H2,1-2H3 |
| InChIKey | MLGPORHJLDWBFH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 160.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|