C25H29N5O7 — CID 3838017
ethyl 3-[[6-[benzyl-(2-ethoxy-2-oxoethyl)amino]-5-nitropyrimidin-4-yl]-(furan-2-ylmethyl)amino]propanoate (PubChem CID 3838017) has the molecular formula C25H29N5O7 and a molecular weight of 511.54 g/mol. Its IUPAC name is ethyl 3-[[6-[benzyl-(2-ethoxy-2-oxoethyl)amino]-5-nitropyrimidin-4-yl]-(furan-2-ylmethyl)amino]propanoate.
| Compound Name | ethyl 3-[[6-[benzyl-(2-ethoxy-2-oxoethyl)amino]-5-nitropyrimidin-4-yl]-(furan-2-ylmethyl)amino]propanoate |
|---|---|
| PubChem CID | 3838017 |
| Molecular Formula | C25H29N5O7 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | ethyl 3-[[6-[benzyl-(2-ethoxy-2-oxoethyl)amino]-5-nitropyrimidin-4-yl]-(furan-2-ylmethyl)amino]propanoate |
| SMILES | CCOC(=O)CCN(Cc1ccco1)c1ncnc(N(CC(=O)OCC)Cc2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C25H29N5O7/c1-3-35-21(31)12-13-28(16-20-11-8-14-37-20)24-23(30(33)34)25(27-18-26-24)29(17-22(32)36-4-2)15-19-9-6-5-7-10-19/h5-11,14,18H,3-4,12-13,15-17H2,1-2H3 |
| InChIKey | RAENSMKWZHTSJQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 141.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|