C23H22N6O6 — CID 3559109
ethyl 3-[furan-2-ylmethyl-[6-(4-imidazol-1-ylphenoxy)-5-nitropyrimidin-4-yl]amino]propanoate (PubChem CID 3559109) has the molecular formula C23H22N6O6 and a molecular weight of 478.47 g/mol. Its IUPAC name is ethyl 3-[furan-2-ylmethyl-[6-(4-imidazol-1-ylphenoxy)-5-nitropyrimidin-4-yl]amino]propanoate.
| Compound Name | ethyl 3-[furan-2-ylmethyl-[6-(4-imidazol-1-ylphenoxy)-5-nitropyrimidin-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 3559109 |
| Molecular Formula | C23H22N6O6 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | ethyl 3-[furan-2-ylmethyl-[6-(4-imidazol-1-ylphenoxy)-5-nitropyrimidin-4-yl]amino]propanoate |
| SMILES | CCOC(=O)CCN(Cc1ccco1)c1ncnc(Oc2ccc(-n3ccnc3)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H22N6O6/c1-2-33-20(30)9-11-27(14-19-4-3-13-34-19)22-21(29(31)32)23(26-15-25-22)35-18-7-5-17(6-8-18)28-12-10-24-16-28/h3-8,10,12-13,15-16H,2,9,11,14H2,1H3 |
| InChIKey | BTICCSTWHLZODW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 138.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|