C21H29N5O7 — CID 3836943
methyl 6-[[6-[(3-ethoxy-3-oxopropyl)-(furan-2-ylmethyl)amino]-5-nitropyrimidin-4-yl]amino]hexanoate (PubChem CID 3836943) has the molecular formula C21H29N5O7 and a molecular weight of 463.49 g/mol. Its IUPAC name is methyl 6-[[6-[(3-ethoxy-3-oxopropyl)-(furan-2-ylmethyl)amino]-5-nitropyrimidin-4-yl]amino]hexanoate.
| Compound Name | methyl 6-[[6-[(3-ethoxy-3-oxopropyl)-(furan-2-ylmethyl)amino]-5-nitropyrimidin-4-yl]amino]hexanoate |
|---|---|
| PubChem CID | 3836943 |
| Molecular Formula | C21H29N5O7 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | methyl 6-[[6-[(3-ethoxy-3-oxopropyl)-(furan-2-ylmethyl)amino]-5-nitropyrimidin-4-yl]amino]hexanoate |
| SMILES | CCOC(=O)CCN(Cc1ccco1)c1ncnc(NCCCCCC(=O)OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H29N5O7/c1-3-32-18(28)10-12-25(14-16-8-7-13-33-16)21-19(26(29)30)20(23-15-24-21)22-11-6-4-5-9-17(27)31-2/h7-8,13,15H,3-6,9-12,14H2,1-2H3,(H,22,23,24) |
| InChIKey | WJXBEFDJHINHDV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 149.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|