C21H18FN5O6 — CID 3500188
ethyl 3-[[6-(4-cyano-3-fluorophenoxy)-5-nitropyrimidin-4-yl]-(furan-2-ylmethyl)amino]propanoate (PubChem CID 3500188) has the molecular formula C21H18FN5O6 and a molecular weight of 455.40 g/mol. Its IUPAC name is ethyl 3-[[6-(4-cyano-3-fluorophenoxy)-5-nitropyrimidin-4-yl]-(furan-2-ylmethyl)amino]propanoate.
| Compound Name | ethyl 3-[[6-(4-cyano-3-fluorophenoxy)-5-nitropyrimidin-4-yl]-(furan-2-ylmethyl)amino]propanoate |
|---|---|
| PubChem CID | 3500188 |
| Molecular Formula | C21H18FN5O6 |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | ethyl 3-[[6-(4-cyano-3-fluorophenoxy)-5-nitropyrimidin-4-yl]-(furan-2-ylmethyl)amino]propanoate |
| SMILES | CCOC(=O)CCN(Cc1ccco1)c1ncnc(Oc2ccc(C#N)c(F)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H18FN5O6/c1-2-31-18(28)7-8-26(12-16-4-3-9-32-16)20-19(27(29)30)21(25-13-24-20)33-15-6-5-14(11-23)17(22)10-15/h3-6,9-10,13H,2,7-8,12H2,1H3 |
| InChIKey | WLZBSGGOMSLLGB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 144.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|