C22H25N5O6 — CID 3803744
ethyl 3-[furan-2-ylmethyl-[5-nitro-6-(2-phenoxyethylamino)pyrimidin-4-yl]amino]propanoate (PubChem CID 3803744) has the molecular formula C22H25N5O6 and a molecular weight of 455.47 g/mol. Its IUPAC name is ethyl 3-[furan-2-ylmethyl-[5-nitro-6-(2-phenoxyethylamino)pyrimidin-4-yl]amino]propanoate.
| Compound Name | ethyl 3-[furan-2-ylmethyl-[5-nitro-6-(2-phenoxyethylamino)pyrimidin-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 3803744 |
| Molecular Formula | C22H25N5O6 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | ethyl 3-[furan-2-ylmethyl-[5-nitro-6-(2-phenoxyethylamino)pyrimidin-4-yl]amino]propanoate |
| SMILES | CCOC(=O)CCN(Cc1ccco1)c1ncnc(NCCOc2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H25N5O6/c1-2-31-19(28)10-12-26(15-18-9-6-13-32-18)22-20(27(29)30)21(24-16-25-22)23-11-14-33-17-7-4-3-5-8-17/h3-9,13,16H,2,10-12,14-15H2,1H3,(H,23,24,25) |
| InChIKey | RXUQFZVCZWMAQJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|