C21H24N6O5 — CID 3740893
ethyl 3-[furan-2-ylmethyl-[5-nitro-6-(2-pyridin-3-ylethylamino)pyrimidin-4-yl]amino]propanoate (PubChem CID 3740893) has the molecular formula C21H24N6O5 and a molecular weight of 440.46 g/mol. Its IUPAC name is ethyl 3-[furan-2-ylmethyl-[5-nitro-6-(2-pyridin-3-ylethylamino)pyrimidin-4-yl]amino]propanoate.
| Compound Name | ethyl 3-[furan-2-ylmethyl-[5-nitro-6-(2-pyridin-3-ylethylamino)pyrimidin-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 3740893 |
| Molecular Formula | C21H24N6O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | ethyl 3-[furan-2-ylmethyl-[5-nitro-6-(2-pyridin-3-ylethylamino)pyrimidin-4-yl]amino]propanoate |
| SMILES | CCOC(=O)CCN(Cc1ccco1)c1ncnc(NCCc2cccnc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H24N6O5/c1-2-31-18(28)8-11-26(14-17-6-4-12-32-17)21-19(27(29)30)20(24-15-25-21)23-10-7-16-5-3-9-22-13-16/h3-6,9,12-13,15H,2,7-8,10-11,14H2,1H3,(H,23,24,25) |
| InChIKey | HKRISJKRZFWYGH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 136.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|