C26H30N6O4 — CID 5154434
ethyl 2-[benzyl-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]amino]acetate (PubChem CID 5154434) has the molecular formula C26H30N6O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is ethyl 2-[benzyl-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]amino]acetate.
| Compound Name | ethyl 2-[benzyl-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]amino]acetate |
|---|---|
| PubChem CID | 5154434 |
| Molecular Formula | C26H30N6O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | ethyl 2-[benzyl-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]amino]acetate |
| SMILES | CCOC(=O)CN(Cc1ccccc1)c1ncnc(N2CCN(Cc3ccccc3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C26H30N6O4/c1-2-36-23(33)19-31(18-22-11-7-4-8-12-22)26-24(32(34)35)25(27-20-28-26)30-15-13-29(14-16-30)17-21-9-5-3-6-10-21/h3-12,20H,2,13-19H2,1H3 |
| InChIKey | YEYJANRWPAHCDS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 104.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|