C21H28N6O4 — CID 89445604
ethyl 2-[(6-amino-2-methyl-5-nitropyrimidin-4-yl)-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]acetate (PubChem CID 89445604) has the molecular formula C21H28N6O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is ethyl 2-[(6-amino-2-methyl-5-nitropyrimidin-4-yl)-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]acetate.
| Compound Name | ethyl 2-[(6-amino-2-methyl-5-nitropyrimidin-4-yl)-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]acetate |
|---|---|
| PubChem CID | 89445604 |
| Molecular Formula | C21H28N6O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | ethyl 2-[(6-amino-2-methyl-5-nitropyrimidin-4-yl)-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]acetate |
| SMILES | CCOC(=O)CN(Cc1ccc(CN2CCCC2)cc1)c1nc(C)nc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H28N6O4/c1-3-31-18(28)14-26(21-19(27(29)30)20(22)23-15(2)24-21)13-17-8-6-16(7-9-17)12-25-10-4-5-11-25/h6-9H,3-5,10-14H2,1-2H3,(H2,22,23,24) |
| InChIKey | WPCUXAYYPIJVTP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|