C22H29N5O4S — CID 118671210
ethyl 2-[(6-amino-2-methylsulfanyl-5-nitropyrimidin-4-yl)-[[3-(cyclopentylmethyl)phenyl]methyl]amino]acetate (PubChem CID 118671210) has the molecular formula C22H29N5O4S and a molecular weight of 459.57 g/mol. Its IUPAC name is ethyl 2-[(6-amino-2-methylsulfanyl-5-nitropyrimidin-4-yl)-[[3-(cyclopentylmethyl)phenyl]methyl]amino]acetate.
| Compound Name | ethyl 2-[(6-amino-2-methylsulfanyl-5-nitropyrimidin-4-yl)-[[3-(cyclopentylmethyl)phenyl]methyl]amino]acetate |
|---|---|
| PubChem CID | 118671210 |
| Molecular Formula | C22H29N5O4S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | ethyl 2-[(6-amino-2-methylsulfanyl-5-nitropyrimidin-4-yl)-[[3-(cyclopentylmethyl)phenyl]methyl]amino]acetate |
| SMILES | CCOC(=O)CN(Cc1cccc(CC2CCCC2)c1)c1nc(SC)nc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H29N5O4S/c1-3-31-18(28)14-26(21-19(27(29)30)20(23)24-22(25-21)32-2)13-17-10-6-9-16(12-17)11-15-7-4-5-8-15/h6,9-10,12,15H,3-5,7-8,11,13-14H2,1-2H3,(H2,23,24,25) |
| InChIKey | UWPCCJQNSNSSII-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 124.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|