C24H34N8O5 — CID 126582031
ethyl 2-[[6-(aminodiazenyl)-2-butoxy-5-nitropyrimidin-4-yl]-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]acetate (PubChem CID 126582031) has the molecular formula C24H34N8O5 and a molecular weight of 514.59 g/mol. Its IUPAC name is ethyl 2-[[6-(aminodiazenyl)-2-butoxy-5-nitropyrimidin-4-yl]-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]acetate.
| Compound Name | ethyl 2-[[6-(aminodiazenyl)-2-butoxy-5-nitropyrimidin-4-yl]-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]acetate |
|---|---|
| PubChem CID | 126582031 |
| Molecular Formula | C24H34N8O5 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | ethyl 2-[[6-(aminodiazenyl)-2-butoxy-5-nitropyrimidin-4-yl]-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]acetate |
| SMILES | CCCCOc1nc(N=NN)c([N+](=O)[O-])c(N(CC(=O)OCC)Cc2cccc(CN3CCCC3)c2)n1 |
| InChI | InChI=1S/C24H34N8O5/c1-3-5-13-37-24-26-22(28-29-25)21(32(34)35)23(27-24)31(17-20(33)36-4-2)16-19-10-8-9-18(14-19)15-30-11-6-7-12-30/h8-10,14H,3-7,11-13,15-17H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | FAMLDXXEHRNZIZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 161.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|