C25H33F3N6O4 — CID 163429956
ethyl 2-[[6-amino-5-nitro-2-(5,5,5-trifluoropentyl)pyrimidin-4-yl]-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]acetate (PubChem CID 163429956) has the molecular formula C25H33F3N6O4 and a molecular weight of 538.57 g/mol. Its IUPAC name is ethyl 2-[[6-amino-5-nitro-2-(5,5,5-trifluoropentyl)pyrimidin-4-yl]-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]acetate.
| Compound Name | ethyl 2-[[6-amino-5-nitro-2-(5,5,5-trifluoropentyl)pyrimidin-4-yl]-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]acetate |
|---|---|
| PubChem CID | 163429956 |
| Molecular Formula | C25H33F3N6O4 |
| Molecular Weight | 538.57 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | ethyl 2-[[6-amino-5-nitro-2-(5,5,5-trifluoropentyl)pyrimidin-4-yl]-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]acetate |
| SMILES | CCOC(=O)CN(Cc1cccc(CN2CCCC2)c1)c1nc(CCCCC(F)(F)F)nc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C25H33F3N6O4/c1-2-38-21(35)17-33(16-19-9-7-8-18(14-19)15-32-12-5-6-13-32)24-22(34(36)37)23(29)30-20(31-24)10-3-4-11-25(26,27)28/h7-9,14H,2-6,10-13,15-17H2,1H3,(H2,29,30,31) |
| InChIKey | APQABCFBJQWQOX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|