C25H36ClN7O5 — CID 162308948
ethyl 2-[[6-amino-2-[methyl(propyl)carbamoyl]-5-nitropyrimidin-4-yl]-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]acetate;hydrochloride (PubChem CID 162308948) has the molecular formula C25H36ClN7O5 and a molecular weight of 550.06 g/mol. Its IUPAC name is ethyl 2-[[6-amino-2-[methyl(propyl)carbamoyl]-5-nitropyrimidin-4-yl]-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]acetate;hydrochloride.
| Compound Name | ethyl 2-[[6-amino-2-[methyl(propyl)carbamoyl]-5-nitropyrimidin-4-yl]-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]acetate;hydrochloride |
|---|---|
| PubChem CID | 162308948 |
| Molecular Formula | C25H36ClN7O5 |
| Molecular Weight | 550.06 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | ethyl 2-[[6-amino-2-[methyl(propyl)carbamoyl]-5-nitropyrimidin-4-yl]-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]acetate;hydrochloride |
| SMILES | CCCN(C)C(=O)c1nc(N)c([N+](=O)[O-])c(N(CC(=O)OCC)Cc2ccc(CN3CCCC3)cc2)n1.Cl |
| InChI | InChI=1S/C25H35N7O5.ClH/c1-4-12-29(3)25(34)23-27-22(26)21(32(35)36)24(28-23)31(17-20(33)37-5-2)16-19-10-8-18(9-11-19)15-30-13-6-7-14-30;/h8-11H,4-7,12-17H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | WVGVFIMOWVOAHQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 148.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.06 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|