C21H25IN6O5 — CID 89052846
ethyl 2-[(6-amino-2-carboniodidoyl-5-nitropyrimidin-4-yl)-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]acetate (PubChem CID 89052846) has the molecular formula C21H25IN6O5 and a molecular weight of 568.37 g/mol. Its IUPAC name is ethyl 2-[(6-amino-2-carboniodidoyl-5-nitropyrimidin-4-yl)-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]acetate.
| Compound Name | ethyl 2-[(6-amino-2-carboniodidoyl-5-nitropyrimidin-4-yl)-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]acetate |
|---|---|
| PubChem CID | 89052846 |
| Molecular Formula | C21H25IN6O5 |
| Molecular Weight | 568.37 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | ethyl 2-[(6-amino-2-carboniodidoyl-5-nitropyrimidin-4-yl)-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]amino]acetate |
| SMILES | CCOC(=O)CN(Cc1cccc(CN2CCCC2)c1)c1nc(C(=O)I)nc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H25IN6O5/c1-2-33-16(29)13-27(21-17(28(31)32)19(23)24-20(25-21)18(22)30)12-15-7-5-6-14(10-15)11-26-8-3-4-9-26/h5-7,10H,2-4,8-9,11-13H2,1H3,(H2,23,24,25) |
| InChIKey | XMYKQZXRECHUJR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 144.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|