C27H44ClN7O4S — CID 91616247
6-chloro-2-methylsulfanyl-5-nitropyrimidin-4-amine;N,N-diethylethanamine;ethyl 2-[[3-(pyrrolidin-1-ylmethyl)phenyl]methylamino]acetate (PubChem CID 91616247) has the molecular formula C27H44ClN7O4S and a molecular weight of 598.21 g/mol. Its IUPAC name is 6-chloro-2-methylsulfanyl-5-nitropyrimidin-4-amine;N,N-diethylethanamine;ethyl 2-[[3-(pyrrolidin-1-ylmethyl)phenyl]methylamino]acetate.
| Compound Name | 6-chloro-2-methylsulfanyl-5-nitropyrimidin-4-amine;N,N-diethylethanamine;ethyl 2-[[3-(pyrrolidin-1-ylmethyl)phenyl]methylamino]acetate |
|---|---|
| PubChem CID | 91616247 |
| Molecular Formula | C27H44ClN7O4S |
| Molecular Weight | 598.21 g/mol |
| Exact Mass | 597.29 |
| IUPAC Name | 6-chloro-2-methylsulfanyl-5-nitropyrimidin-4-amine;N,N-diethylethanamine;ethyl 2-[[3-(pyrrolidin-1-ylmethyl)phenyl]methylamino]acetate |
| SMILES | CCN(CC)CC.CCOC(=O)CNCc1cccc(CN2CCCC2)c1.CSc1nc(N)c([N+](=O)[O-])c(Cl)n1 |
| InChI | InChI=1S/C16H24N2O2.C6H15N.C5H5ClN4O2S/c1-2-20-16(19)12-17-11-14-6-5-7-15(10-14)13-18-8-3-4-9-18;1-4-7(5-2)6-3;1-13-5-8-3(6)2(10(11)12)4(7)9-5/h5-7,10,17H,2-4,8-9,11-13H2,1H3;4-6H2,1-3H3;1H3,(H2,7,8,9) |
| InChIKey | UFRLKHMJKUUGJZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 139.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.21 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|