C27H25N5O2 — CID 23488331
N,N-dibenzyl-6-(3,4-dihydro-1H-isoquinolin-2-yl)-5-nitropyrimidin-4-amine (PubChem CID 23488331) has the molecular formula C27H25N5O2 and a molecular weight of 451.53 g/mol. Its IUPAC name is N,N-dibenzyl-6-(3,4-dihydro-1H-isoquinolin-2-yl)-5-nitropyrimidin-4-amine.
| Compound Name | N,N-dibenzyl-6-(3,4-dihydro-1H-isoquinolin-2-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23488331 |
| Molecular Formula | C27H25N5O2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | N,N-dibenzyl-6-(3,4-dihydro-1H-isoquinolin-2-yl)-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(N(Cc2ccccc2)Cc2ccccc2)ncnc1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C27H25N5O2/c33-32(34)25-26(30-16-15-23-13-7-8-14-24(23)19-30)28-20-29-27(25)31(17-21-9-3-1-4-10-21)18-22-11-5-2-6-12-22/h1-14,20H,15-19H2 |
| InChIKey | CGWBWHPTXCCOPU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|