C19H16FN5O2 — CID 22527662
6-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-fluorophenyl)-5-nitropyrimidin-4-amine (PubChem CID 22527662) has the molecular formula C19H16FN5O2 and a molecular weight of 365.37 g/mol. Its IUPAC name is 6-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-fluorophenyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-fluorophenyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22527662 |
| Molecular Formula | C19H16FN5O2 |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 6-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-fluorophenyl)-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2ccccc2F)ncnc1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H16FN5O2/c20-15-7-3-4-8-16(15)23-18-17(25(26)27)19(22-12-21-18)24-10-9-13-5-1-2-6-14(13)11-24/h1-8,12H,9-11H2,(H,21,22,23) |
| InChIKey | SMBBPVULIQWBTO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|