C18H13F2N5O2 — CID 23481857
N-(2,5-difluorophenyl)-6-(2,3-dihydroindol-1-yl)-5-nitropyrimidin-4-amine (PubChem CID 23481857) has the molecular formula C18H13F2N5O2 and a molecular weight of 369.33 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-6-(2,3-dihydroindol-1-yl)-5-nitropyrimidin-4-amine.
| Compound Name | N-(2,5-difluorophenyl)-6-(2,3-dihydroindol-1-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23481857 |
| Molecular Formula | C18H13F2N5O2 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | N-(2,5-difluorophenyl)-6-(2,3-dihydroindol-1-yl)-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2cc(F)ccc2F)ncnc1N1CCc2ccccc21 |
| InChI | InChI=1S/C18H13F2N5O2/c19-12-5-6-13(20)14(9-12)23-17-16(25(26)27)18(22-10-21-17)24-8-7-11-3-1-2-4-15(11)24/h1-6,9-10H,7-8H2,(H,21,22,23) |
| InChIKey | CGXUQIVTXKZLNI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|