C20H16F3N5O2 — CID 22531414
6-(3,4-dihydro-2H-quinolin-1-yl)-5-nitro-N-[3-(trifluoromethyl)phenyl]pyrimidin-4-amine (PubChem CID 22531414) has the molecular formula C20H16F3N5O2 and a molecular weight of 415.38 g/mol. Its IUPAC name is 6-(3,4-dihydro-2H-quinolin-1-yl)-5-nitro-N-[3-(trifluoromethyl)phenyl]pyrimidin-4-amine.
| Compound Name | 6-(3,4-dihydro-2H-quinolin-1-yl)-5-nitro-N-[3-(trifluoromethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 22531414 |
| Molecular Formula | C20H16F3N5O2 |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 6-(3,4-dihydro-2H-quinolin-1-yl)-5-nitro-N-[3-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2cccc(C(F)(F)F)c2)ncnc1N1CCCc2ccccc21 |
| InChI | InChI=1S/C20H16F3N5O2/c21-20(22,23)14-7-3-8-15(11-14)26-18-17(28(29)30)19(25-12-24-18)27-10-4-6-13-5-1-2-9-16(13)27/h1-3,5,7-9,11-12H,4,6,10H2,(H,24,25,26) |
| InChIKey | RRCBQFHGRQWXJS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|