C19H15N7O2 — CID 22531526
1-[6-(benzotriazol-1-yl)-5-nitropyrimidin-4-yl]-3,4-dihydro-2H-quinoline (PubChem CID 22531526) has the molecular formula C19H15N7O2 and a molecular weight of 373.38 g/mol. Its IUPAC name is 1-[6-(benzotriazol-1-yl)-5-nitropyrimidin-4-yl]-3,4-dihydro-2H-quinoline.
| Compound Name | 1-[6-(benzotriazol-1-yl)-5-nitropyrimidin-4-yl]-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 22531526 |
| Molecular Formula | C19H15N7O2 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 1-[6-(benzotriazol-1-yl)-5-nitropyrimidin-4-yl]-3,4-dihydro-2H-quinoline |
| SMILES | O=[N+]([O-])c1c(N2CCCc3ccccc32)ncnc1-n1nnc2ccccc21 |
| InChI | InChI=1S/C19H15N7O2/c27-26(28)17-18(24-11-5-7-13-6-1-3-9-15(13)24)20-12-21-19(17)25-16-10-4-2-8-14(16)22-23-25/h1-4,6,8-10,12H,5,7,11H2 |
| InChIKey | FCPIRJMFBIYIFX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|