C14H15N7O2 — CID 23478853
6-(benzotriazol-1-yl)-N-tert-butyl-5-nitropyrimidin-4-amine (PubChem CID 23478853) has the molecular formula C14H15N7O2 and a molecular weight of 313.32 g/mol. Its IUPAC name is 6-(benzotriazol-1-yl)-N-tert-butyl-5-nitropyrimidin-4-amine.
| Compound Name | 6-(benzotriazol-1-yl)-N-tert-butyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23478853 |
| Molecular Formula | C14H15N7O2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 6-(benzotriazol-1-yl)-N-tert-butyl-5-nitropyrimidin-4-amine |
| SMILES | CC(C)(C)Nc1ncnc(-n2nnc3ccccc32)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15N7O2/c1-14(2,3)17-12-11(21(22)23)13(16-8-15-12)20-10-7-5-4-6-9(10)18-19-20/h4-8H,1-3H3,(H,15,16,17) |
| InChIKey | JVCUNPZFFBYTLC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|