C19H12N8O2 — CID 22527352
N-[6-(benzotriazol-1-yl)-5-nitropyrimidin-4-yl]quinolin-8-amine (PubChem CID 22527352) has the molecular formula C19H12N8O2 and a molecular weight of 384.36 g/mol. Its IUPAC name is N-[6-(benzotriazol-1-yl)-5-nitropyrimidin-4-yl]quinolin-8-amine.
| Compound Name | N-[6-(benzotriazol-1-yl)-5-nitropyrimidin-4-yl]quinolin-8-amine |
|---|---|
| PubChem CID | 22527352 |
| Molecular Formula | C19H12N8O2 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N-[6-(benzotriazol-1-yl)-5-nitropyrimidin-4-yl]quinolin-8-amine |
| SMILES | O=[N+]([O-])c1c(Nc2cccc3cccnc23)ncnc1-n1nnc2ccccc21 |
| InChI | InChI=1S/C19H12N8O2/c28-27(29)17-18(23-14-8-3-5-12-6-4-10-20-16(12)14)21-11-22-19(17)26-15-9-2-1-7-13(15)24-25-26/h1-11H,(H,21,22,23) |
| InChIKey | UYFUVGUQYYSHSP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|