C16H9BrFN7O2 — CID 22537752
6-(benzotriazol-1-yl)-N-(4-bromo-2-fluorophenyl)-5-nitropyrimidin-4-amine (PubChem CID 22537752) has the molecular formula C16H9BrFN7O2 and a molecular weight of 430.20 g/mol. Its IUPAC name is 6-(benzotriazol-1-yl)-N-(4-bromo-2-fluorophenyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(benzotriazol-1-yl)-N-(4-bromo-2-fluorophenyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22537752 |
| Molecular Formula | C16H9BrFN7O2 |
| Molecular Weight | 430.20 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | 6-(benzotriazol-1-yl)-N-(4-bromo-2-fluorophenyl)-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc(Br)cc2F)ncnc1-n1nnc2ccccc21 |
| InChI | InChI=1S/C16H9BrFN7O2/c17-9-5-6-11(10(18)7-9)21-15-14(25(26)27)16(20-8-19-15)24-13-4-2-1-3-12(13)22-23-24/h1-8H,(H,19,20,21) |
| InChIKey | GMUINWZFTNIDPD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|