C18H13N9O5 — CID 22536893
N'-[6-(benzotriazol-1-yl)-5-nitropyrimidin-4-yl]-2-(4-nitrophenyl)acetohydrazide (PubChem CID 22536893) has the molecular formula C18H13N9O5 and a molecular weight of 435.36 g/mol. Its IUPAC name is N'-[6-(benzotriazol-1-yl)-5-nitropyrimidin-4-yl]-2-(4-nitrophenyl)acetohydrazide.
| Compound Name | N'-[6-(benzotriazol-1-yl)-5-nitropyrimidin-4-yl]-2-(4-nitrophenyl)acetohydrazide |
|---|---|
| PubChem CID | 22536893 |
| Molecular Formula | C18H13N9O5 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | N'-[6-(benzotriazol-1-yl)-5-nitropyrimidin-4-yl]-2-(4-nitrophenyl)acetohydrazide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)NNc1ncnc(-n2nnc3ccccc32)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H13N9O5/c28-15(9-11-5-7-12(8-6-11)26(29)30)22-23-17-16(27(31)32)18(20-10-19-17)25-14-4-2-1-3-13(14)21-24-25/h1-8,10H,9H2,(H,22,28)(H,19,20,23) |
| InChIKey | IXJDRIKNYMYXRO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 183.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|