C18H14N8O3 — CID 22537094
N'-[6-(benzotriazol-1-yl)-5-nitropyrimidin-4-yl]-2-phenylacetohydrazide (PubChem CID 22537094) has the molecular formula C18H14N8O3 and a molecular weight of 390.36 g/mol. Its IUPAC name is N'-[6-(benzotriazol-1-yl)-5-nitropyrimidin-4-yl]-2-phenylacetohydrazide.
| Compound Name | N'-[6-(benzotriazol-1-yl)-5-nitropyrimidin-4-yl]-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 22537094 |
| Molecular Formula | C18H14N8O3 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N'-[6-(benzotriazol-1-yl)-5-nitropyrimidin-4-yl]-2-phenylacetohydrazide |
| SMILES | O=C(Cc1ccccc1)NNc1ncnc(-n2nnc3ccccc32)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14N8O3/c27-15(10-12-6-2-1-3-7-12)22-23-17-16(26(28)29)18(20-11-19-17)25-14-9-5-4-8-13(14)21-24-25/h1-9,11H,10H2,(H,22,27)(H,19,20,23) |
| InChIKey | MZFLJNXLVUVTJW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 140.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|