C18H13N7O2 — CID 22527227
5-nitro-4-N-pyridin-2-yl-6-N-quinolin-8-ylpyrimidine-4,6-diamine (PubChem CID 22527227) has the molecular formula C18H13N7O2 and a molecular weight of 359.35 g/mol. Its IUPAC name is 5-nitro-4-N-pyridin-2-yl-6-N-quinolin-8-ylpyrimidine-4,6-diamine.
| Compound Name | 5-nitro-4-N-pyridin-2-yl-6-N-quinolin-8-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22527227 |
| Molecular Formula | C18H13N7O2 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 5-nitro-4-N-pyridin-2-yl-6-N-quinolin-8-ylpyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2ccccn2)ncnc1Nc1cccc2cccnc12 |
| InChI | InChI=1S/C18H13N7O2/c26-25(27)16-17(21-11-22-18(16)24-14-8-1-2-9-19-14)23-13-7-3-5-12-6-4-10-20-15(12)13/h1-11H,(H2,19,21,22,23,24) |
| InChIKey | AKXOCBAEWVBRNA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 118.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|