C23H16N6O2 — CID 22527211
6-N-naphthalen-1-yl-5-nitro-4-N-quinolin-8-ylpyrimidine-4,6-diamine (PubChem CID 22527211) has the molecular formula C23H16N6O2 and a molecular weight of 408.42 g/mol. Its IUPAC name is 6-N-naphthalen-1-yl-5-nitro-4-N-quinolin-8-ylpyrimidine-4,6-diamine.
| Compound Name | 6-N-naphthalen-1-yl-5-nitro-4-N-quinolin-8-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22527211 |
| Molecular Formula | C23H16N6O2 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 6-N-naphthalen-1-yl-5-nitro-4-N-quinolin-8-ylpyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2cccc3ccccc23)ncnc1Nc1cccc2cccnc12 |
| InChI | InChI=1S/C23H16N6O2/c30-29(31)21-22(27-18-11-3-7-15-6-1-2-10-17(15)18)25-14-26-23(21)28-19-12-4-8-16-9-5-13-24-20(16)19/h1-14H,(H2,25,26,27,28) |
| InChIKey | AMSUKACORZFUGK-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|