C18H13N7O2 — CID 23481888
1-[6-(2,3-dihydroindol-1-yl)-5-nitropyrimidin-4-yl]benzotriazole (PubChem CID 23481888) has the molecular formula C18H13N7O2 and a molecular weight of 359.35 g/mol. Its IUPAC name is 1-[6-(2,3-dihydroindol-1-yl)-5-nitropyrimidin-4-yl]benzotriazole.
| Compound Name | 1-[6-(2,3-dihydroindol-1-yl)-5-nitropyrimidin-4-yl]benzotriazole |
|---|---|
| PubChem CID | 23481888 |
| Molecular Formula | C18H13N7O2 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 1-[6-(2,3-dihydroindol-1-yl)-5-nitropyrimidin-4-yl]benzotriazole |
| SMILES | O=[N+]([O-])c1c(N2CCc3ccccc32)ncnc1-n1nnc2ccccc21 |
| InChI | InChI=1S/C18H13N7O2/c26-25(27)16-17(23-10-9-12-5-1-3-7-14(12)23)19-11-20-18(16)24-15-8-4-2-6-13(15)21-22-24/h1-8,11H,9-10H2 |
| InChIKey | QSUIXGYGDDFSKK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|