C14H24N6O2 — CID 23488659
N,N-diethyl-6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-amine (PubChem CID 23488659) has the molecular formula C14H24N6O2 and a molecular weight of 308.39 g/mol. Its IUPAC name is N,N-diethyl-6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-amine.
| Compound Name | N,N-diethyl-6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23488659 |
| Molecular Formula | C14H24N6O2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | N,N-diethyl-6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-amine |
| SMILES | CCN1CCN(c2ncnc(N(CC)CC)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C14H24N6O2/c1-4-17-7-9-19(10-8-17)14-12(20(21)22)13(15-11-16-14)18(5-2)6-3/h11H,4-10H2,1-3H3 |
| InChIKey | LFKAWKOICIEAIP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 78.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|