C15H21N7O2 — CID 23490427
4-(3,5-dimethylpyrazol-1-yl)-6-(4-ethylpiperazin-1-yl)-5-nitropyrimidine (PubChem CID 23490427) has the molecular formula C15H21N7O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 4-(3,5-dimethylpyrazol-1-yl)-6-(4-ethylpiperazin-1-yl)-5-nitropyrimidine.
| Compound Name | 4-(3,5-dimethylpyrazol-1-yl)-6-(4-ethylpiperazin-1-yl)-5-nitropyrimidine |
|---|---|
| PubChem CID | 23490427 |
| Molecular Formula | C15H21N7O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 4-(3,5-dimethylpyrazol-1-yl)-6-(4-ethylpiperazin-1-yl)-5-nitropyrimidine |
| SMILES | CCN1CCN(c2ncnc(-n3nc(C)cc3C)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H21N7O2/c1-4-19-5-7-20(8-6-19)14-13(22(23)24)15(17-10-16-14)21-12(3)9-11(2)18-21/h9-10H,4-8H2,1-3H3 |
| InChIKey | FZWCWEIAYVMNGF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|