C14H23N7O2 — CID 7584049
4,6-bis(4-methylpiperazin-1-yl)-5-nitropyrimidine (PubChem CID 7584049) has the molecular formula C14H23N7O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 4,6-bis(4-methylpiperazin-1-yl)-5-nitropyrimidine.
| Compound Name | 4,6-bis(4-methylpiperazin-1-yl)-5-nitropyrimidine |
|---|---|
| PubChem CID | 7584049 |
| Molecular Formula | C14H23N7O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 4,6-bis(4-methylpiperazin-1-yl)-5-nitropyrimidine |
| SMILES | CN1CCN(c2ncnc(N3CCN(C)CC3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C14H23N7O2/c1-17-3-7-19(8-4-17)13-12(21(22)23)14(16-11-15-13)20-9-5-18(2)6-10-20/h11H,3-10H2,1-2H3 |
| InChIKey | JBWKSDUANUQBDV-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 81.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|