About (7-methyl-2-oxochromen-4-yl)methyl 2-(2-nitrophenyl)acetate
(7-methyl-2-oxochromen-4-yl)methyl 2-(2-nitrophenyl)acetate (PubChem CID 3310308) has the molecular formula C19H15NO6
and a molecular weight of 353.33 g/mol. Its IUPAC name is (7-methyl-2-oxochromen-4-yl)methyl 2-(2-nitrophenyl)acetate.
Molecular Properties
| Compound Name | (7-methyl-2-oxochromen-4-yl)methyl 2-(2-nitrophenyl)acetate |
| PubChem CID | 3310308 |
| Molecular Formula | C19H15NO6 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | (7-methyl-2-oxochromen-4-yl)methyl 2-(2-nitrophenyl)acetate |
| SMILES | Cc1ccc2c(COC(=O)Cc3ccccc3[N+](=O)[O-])cc(=O)oc2c1 |
| InChI | InChI=1S/C19H15NO6/c1-12-6-7-15-14(10-19(22)26-17(15)8-12)11-25-18(21)9-13-4-2-3-5-16(13)20(23)24/h2-8,10H,9,11H2,1H3 |
| InChIKey | QQDOBAPDLSCINI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 99.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (7-methyl-2-oxochromen-4-yl)methyl 2-(2-nitrophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methyl-2-oxochromen-4-yl)methyl 2-(2-nitrophenyl)acetate?
The IUPAC name of (7-methyl-2-oxochromen-4-yl)methyl 2-(2-nitrophenyl)acetate (CID 3310308) is (7-methyl-2-oxochromen-4-yl)methyl 2-(2-nitrophenyl)acetate.
What is the SMILES notation for (7-methyl-2-oxochromen-4-yl)methyl 2-(2-nitrophenyl)acetate?
The canonical SMILES for (7-methyl-2-oxochromen-4-yl)methyl 2-(2-nitrophenyl)acetate is Cc1ccc2c(COC(=O)Cc3ccccc3[N+](=O)[O-])cc(=O)oc2c1.
What is the InChIKey of (7-methyl-2-oxochromen-4-yl)methyl 2-(2-nitrophenyl)acetate?
The InChIKey is QQDOBAPDLSCINI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO6/c1-12-6-7-15-14(10-19(22)26-17(15)8-12)11-25-18(21)9-13-4-2-3-5-16(13)20(23)24/h2-8,10H,9,11H2,1H3.
What are the key properties of (7-methyl-2-oxochromen-4-yl)methyl 2-(2-nitrophenyl)acetate?
(7-methyl-2-oxochromen-4-yl)methyl 2-(2-nitrophenyl)acetate has a molecular weight of 353.33 g/mol, XLogP of 3.30, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methyl-2-oxochromen-4-yl)methyl 2-(2-nitrophenyl)acetate is sourced from PubChem (CID 3310308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).