About (7-methyl-2-oxochromen-4-yl)methyl 3-methyl-2-nitrobenzoate
(7-methyl-2-oxochromen-4-yl)methyl 3-methyl-2-nitrobenzoate (PubChem CID 3692871) has the molecular formula C19H15NO6
and a molecular weight of 353.33 g/mol. Its IUPAC name is (7-methyl-2-oxochromen-4-yl)methyl 3-methyl-2-nitrobenzoate.
Molecular Properties
| Compound Name | (7-methyl-2-oxochromen-4-yl)methyl 3-methyl-2-nitrobenzoate |
| PubChem CID | 3692871 |
| Molecular Formula | C19H15NO6 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | (7-methyl-2-oxochromen-4-yl)methyl 3-methyl-2-nitrobenzoate |
| SMILES | Cc1ccc2c(COC(=O)c3cccc(C)c3[N+](=O)[O-])cc(=O)oc2c1 |
| InChI | InChI=1S/C19H15NO6/c1-11-6-7-14-13(9-17(21)26-16(14)8-11)10-25-19(22)15-5-3-4-12(2)18(15)20(23)24/h3-9H,10H2,1-2H3 |
| InChIKey | OMMVDTUGPBJHNE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 99.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (7-methyl-2-oxochromen-4-yl)methyl 3-methyl-2-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methyl-2-oxochromen-4-yl)methyl 3-methyl-2-nitrobenzoate?
The IUPAC name of (7-methyl-2-oxochromen-4-yl)methyl 3-methyl-2-nitrobenzoate (CID 3692871) is (7-methyl-2-oxochromen-4-yl)methyl 3-methyl-2-nitrobenzoate.
What is the SMILES notation for (7-methyl-2-oxochromen-4-yl)methyl 3-methyl-2-nitrobenzoate?
The canonical SMILES for (7-methyl-2-oxochromen-4-yl)methyl 3-methyl-2-nitrobenzoate is Cc1ccc2c(COC(=O)c3cccc(C)c3[N+](=O)[O-])cc(=O)oc2c1.
What is the InChIKey of (7-methyl-2-oxochromen-4-yl)methyl 3-methyl-2-nitrobenzoate?
The InChIKey is OMMVDTUGPBJHNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO6/c1-11-6-7-14-13(9-17(21)26-16(14)8-11)10-25-19(22)15-5-3-4-12(2)18(15)20(23)24/h3-9H,10H2,1-2H3.
What are the key properties of (7-methyl-2-oxochromen-4-yl)methyl 3-methyl-2-nitrobenzoate?
(7-methyl-2-oxochromen-4-yl)methyl 3-methyl-2-nitrobenzoate has a molecular weight of 353.33 g/mol, XLogP of 3.68, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methyl-2-oxochromen-4-yl)methyl 3-methyl-2-nitrobenzoate is sourced from PubChem (CID 3692871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).