C21H16O6 — CID 7414844
(7-methyl-2-oxochromen-4-yl)methyl 2-(6-hydroxy-1-benzofuran-3-yl)acetate (PubChem CID 7414844) has the molecular formula C21H16O6 and a molecular weight of 364.35 g/mol. Its IUPAC name is (7-methyl-2-oxochromen-4-yl)methyl 2-(6-hydroxy-1-benzofuran-3-yl)acetate.
| Compound Name | (7-methyl-2-oxochromen-4-yl)methyl 2-(6-hydroxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 7414844 |
| Molecular Formula | C21H16O6 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | (7-methyl-2-oxochromen-4-yl)methyl 2-(6-hydroxy-1-benzofuran-3-yl)acetate |
| SMILES | Cc1ccc2c(COC(=O)Cc3coc4cc(O)ccc34)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H16O6/c1-12-2-4-17-14(8-21(24)27-19(17)6-12)11-26-20(23)7-13-10-25-18-9-15(22)3-5-16(13)18/h2-6,8-10,22H,7,11H2,1H3 |
| InChIKey | ZZPRCMCAZREQQH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|