C18H12Cl2O5 — CID 7951138
(7-hydroxy-2-oxochromen-4-yl)methyl 2-(2,4-dichlorophenyl)acetate (PubChem CID 7951138) has the molecular formula C18H12Cl2O5 and a molecular weight of 379.20 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl 2-(2,4-dichlorophenyl)acetate.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl 2-(2,4-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 7951138 |
| Molecular Formula | C18H12Cl2O5 |
| Molecular Weight | 379.20 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl 2-(2,4-dichlorophenyl)acetate |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)OCc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C18H12Cl2O5/c19-12-2-1-10(15(20)7-12)5-17(22)24-9-11-6-18(23)25-16-8-13(21)3-4-14(11)16/h1-4,6-8,21H,5,9H2 |
| InChIKey | PTUNFNLQYUNBTG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.20 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|