C21H18ClNO6 — CID 30793303
(7-hydroxy-2-oxochromen-4-yl)methyl (3R)-3-acetamido-3-(4-chlorophenyl)propanoate (PubChem CID 30793303) has the molecular formula C21H18ClNO6 and a molecular weight of 415.83 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl (3R)-3-acetamido-3-(4-chlorophenyl)propanoate.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl (3R)-3-acetamido-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 30793303 |
| Molecular Formula | C21H18ClNO6 |
| Molecular Weight | 415.83 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl (3R)-3-acetamido-3-(4-chlorophenyl)propanoate |
| SMILES | CC(=O)N[C@H](CC(=O)OCc1cc(=O)oc2cc(O)ccc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18ClNO6/c1-12(24)23-18(13-2-4-15(22)5-3-13)10-20(26)28-11-14-8-21(27)29-19-9-16(25)6-7-17(14)19/h2-9,18,25H,10-11H2,1H3,(H,23,24)/t18-/m1/s1 |
| InChIKey | NDNZFXFLKUSBJD-GOSISDBHSA-N |
| XLogP | 3.46 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.83 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|