C23H20O6 — CID 7617757
(7-methoxy-2-oxochromen-4-yl)methyl 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate (PubChem CID 7617757) has the molecular formula C23H20O6 and a molecular weight of 392.41 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 7617757 |
| Molecular Formula | C23H20O6 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 2-(6,7-dimethyl-1-benzofuran-3-yl)acetate |
| SMILES | COc1ccc2c(COC(=O)Cc3coc4c(C)c(C)ccc34)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H20O6/c1-13-4-6-19-16(12-28-23(19)14(13)2)8-21(24)27-11-15-9-22(25)29-20-10-17(26-3)5-7-18(15)20/h4-7,9-10,12H,8,11H2,1-3H3 |
| InChIKey | UCMLVIYWTRQDGD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|