C20H20N4O6 — CID 3713515
6-[6-(2,6-dimethylmorpholin-4-yl)-5-nitropyrimidin-4-yl]oxy-4-methylchromen-2-one (PubChem CID 3713515) has the molecular formula C20H20N4O6 and a molecular weight of 412.40 g/mol. Its IUPAC name is 6-[6-(2,6-dimethylmorpholin-4-yl)-5-nitropyrimidin-4-yl]oxy-4-methylchromen-2-one.
| Compound Name | 6-[6-(2,6-dimethylmorpholin-4-yl)-5-nitropyrimidin-4-yl]oxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 3713515 |
| Molecular Formula | C20H20N4O6 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 6-[6-(2,6-dimethylmorpholin-4-yl)-5-nitropyrimidin-4-yl]oxy-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2ccc(Oc3ncnc(N4CC(C)OC(C)C4)c3[N+](=O)[O-])cc12 |
| InChI | InChI=1S/C20H20N4O6/c1-11-6-17(25)30-16-5-4-14(7-15(11)16)29-20-18(24(26)27)19(21-10-22-20)23-8-12(2)28-13(3)9-23/h4-7,10,12-13H,8-9H2,1-3H3 |
| InChIKey | YHNKUVOEVVUQIK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 120.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|