C17H20N6O4 — CID 74227078
(E)-[2-[6-(2,6-dimethylmorpholin-4-yl)-5-nitropyrimidin-4-yl]oxyphenyl]methylidenehydrazine (PubChem CID 74227078) has the molecular formula C17H20N6O4 and a molecular weight of 372.39 g/mol. Its IUPAC name is (E)-[2-[6-(2,6-dimethylmorpholin-4-yl)-5-nitropyrimidin-4-yl]oxyphenyl]methylidenehydrazine.
| Compound Name | (E)-[2-[6-(2,6-dimethylmorpholin-4-yl)-5-nitropyrimidin-4-yl]oxyphenyl]methylidenehydrazine |
|---|---|
| PubChem CID | 74227078 |
| Molecular Formula | C17H20N6O4 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (E)-[2-[6-(2,6-dimethylmorpholin-4-yl)-5-nitropyrimidin-4-yl]oxyphenyl]methylidenehydrazine |
| SMILES | CC1CN(c2ncnc(Oc3ccccc3/C=N/N)c2[N+](=O)[O-])CC(C)O1 |
| InChI | InChI=1S/C17H20N6O4/c1-11-8-22(9-12(2)26-11)16-15(23(24)25)17(20-10-19-16)27-14-6-4-3-5-13(14)7-21-18/h3-7,10-12H,8-9,18H2,1-2H3/b21-7+ |
| InChIKey | WAXLAHRCAQFREU-QPSGOUHRSA-N |
| XLogP | 2.08 |
| TPSA | 129.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|