C22H23ClN8O3 — CID 74225170
N-[(E)-[5-chloro-2-[5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]oxyphenyl]methylideneamino]-N-methylmethanamine (PubChem CID 74225170) has the molecular formula C22H23ClN8O3 and a molecular weight of 482.93 g/mol. Its IUPAC name is N-[(E)-[5-chloro-2-[5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]oxyphenyl]methylideneamino]-N-methylmethanamine.
| Compound Name | N-[(E)-[5-chloro-2-[5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]oxyphenyl]methylideneamino]-N-methylmethanamine |
|---|---|
| PubChem CID | 74225170 |
| Molecular Formula | C22H23ClN8O3 |
| Molecular Weight | 482.93 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | N-[(E)-[5-chloro-2-[5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]oxyphenyl]methylideneamino]-N-methylmethanamine |
| SMILES | CN(C)/N=C/c1cc(Cl)ccc1Oc1ncnc(N2CCN(c3ccccn3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H23ClN8O3/c1-28(2)27-14-16-13-17(23)6-7-18(16)34-22-20(31(32)33)21(25-15-26-22)30-11-9-29(10-12-30)19-5-3-4-8-24-19/h3-8,13-15H,9-12H2,1-2H3/b27-14+ |
| InChIKey | IAUSJVLBRRAHKP-MZJWZYIUSA-N |
| XLogP | 3.45 |
| TPSA | 113.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.93 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|